EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H16O4 |
| Net Charge | 0 |
| Average Mass | 212.245 |
| Monoisotopic Mass | 212.10486 |
| SMILES | [H][C@]12[C@H](O)OC=C(C(=O)OC)[C@@]1([H])CC[C@@H]2C |
| InChI | InChI=1S/C11H16O4/c1-6-3-4-7-8(10(12)14-2)5-15-11(13)9(6)7/h5-7,9,11,13H,3-4H2,1-2H3/t6-,7+,9+,11+/m0/s1 |
| InChIKey | GGFAHFSRIITJIJ-NONSRLQASA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-deoxyloganetin (CHEBI:76849) has functional parent 7-deoxyloganetic acid (CHEBI:77027) |
| 7-deoxyloganetin (CHEBI:76849) has role plant metabolite (CHEBI:76924) |
| 7-deoxyloganetin (CHEBI:76849) is a cyclopentapyran (CHEBI:38606) |
| 7-deoxyloganetin (CHEBI:76849) is a iridoid monoterpenoid (CHEBI:50563) |
| 7-deoxyloganetin (CHEBI:76849) is a lactol (CHEBI:38131) |
| 7-deoxyloganetin (CHEBI:76849) is a methyl ester (CHEBI:25248) |
| IUPAC Name |
|---|
| methyl (1S,4aS,7S,7aR)-1-hydroxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate |
| Synonym | Source |
|---|---|
| methyl 7-deoxyloganetate | ChEBI |
| UniProt Name | Source |
|---|---|
| 7-deoxyloganetin | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1286137 | Reaxys |
| Citations |
|---|