EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H28N3O13P2 |
| Net Charge | -1 |
| Average Mass | 544.367 |
| Monoisotopic Mass | 544.11028 |
| SMILES | Cc1cn([C@H]2C[C@H](O)[C@@H](COP(=O)([O-])OP(=O)([O-])O[C@@H]3C[C@](C)([NH3+])[C@H](O)[C@H](C)O3)O2)c(=O)nc1=O |
| InChI | InChI=1S/C17H29N3O13P2/c1-8-6-20(16(24)19-15(8)23)12-4-10(21)11(31-12)7-29-34(25,26)33-35(27,28)32-13-5-17(3,18)14(22)9(2)30-13/h6,9-14,21-22H,4-5,7,18H2,1-3H3,(H,25,26)(H,27,28)(H,19,23,24)/p-1/t9-,10-,11+,12+,13+,14+,17-/m0/s1 |
| InChIKey | HRODALWRJULFHW-SWNFMPTGSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dTDP-β-L-vancosamine(1−) (CHEBI:76839) is a nucleotide-sugar oxoanion (CHEBI:59737) |
| dTDP-β-L-vancosamine(1−) (CHEBI:76839) is conjugate base of dTDP-β-L-vancosamine (CHEBI:32336) |
| Incoming Relation(s) |
| dTDP-β-L-vancosamine (CHEBI:32336) is conjugate acid of dTDP-β-L-vancosamine(1−) (CHEBI:76839) |
| IUPAC Name |
|---|
| thymidine 5'-{3-[3-azaniumyl-2,3,6-trideoxy-3-methyl-β-L-lyxo-hexopyranosyl] diphosphate} |
| Synonym | Source |
|---|---|
| dTDP-3-amino-2,3,6-trideoxy-3-C-methyl-β-L-lyxo-hexopyranose | SUBMITTER |
| UniProt Name | Source |
|---|---|
| dTDP-β-L-vancosamine | UniProt |
| Citations |
|---|