EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H19O12 |
| Net Charge | -1 |
| Average Mass | 355.272 |
| Monoisotopic Mass | 355.08820 |
| SMILES | O=C[C@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)[C@H](O)[C@H](O)C(=O)[O-] |
| InChI | InChI=1S/C12H20O12/c13-1-3(15)10(7(18)8(19)11(21)22)24-12-9(20)6(17)5(16)4(2-14)23-12/h1,3-10,12,14-20H,2H2,(H,21,22)/p-1/t3-,4+,5+,6-,7+,8-,9+,10+,12-/m0/s1 |
| InChIKey | FZIWWMBARQNGJH-YEOGOCOXSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-O-β-D-glucosyl-D-glucuronate (CHEBI:76826) is a carbohydrate acid anion (CHEBI:33721) |
| 3-O-β-D-glucosyl-D-glucuronate (CHEBI:76826) is conjugate base of 3-O-β-D-glucosyl-D-glucuronic acid (CHEBI:77025) |
| Incoming Relation(s) |
| 3-O-β-D-glucosyl-D-glucuronic acid (CHEBI:77025) is conjugate acid of 3-O-β-D-glucosyl-D-glucuronate (CHEBI:76826) |
| IUPAC Name |
|---|
| β-D-glucopyranosyl-(1→3)-D-glucuronate |
| Synonyms | Source |
|---|---|
| 3-O-β-D-glucopyranosyl-D-glucuronate | IUPAC |
| β-D-glucosyl-(1→3)-D-glucuronate | ChEBI |
| UniProt Name | Source |
|---|---|
| 3-O-β-D-glucosyl-D-glucuronate | UniProt |
| Citations |
|---|