EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H48NO7 |
| Net Charge | +1 |
| Average Mass | 510.692 |
| Monoisotopic Mass | 510.34253 |
| SMILES | CC[C@H]1OC(=O)[C@H](C)C(=O)[C@H](C)[C@@H](O[C@@H]2O[C@H](C)C[C@H]([NH+](C)C)[C@H]2O)[C@@H](C)C[C@@H](C)C(=O)/C=C/[C@H]1C |
| InChI | InChI=1S/C28H47NO7/c1-10-23-15(2)11-12-22(30)16(3)13-17(4)26(19(6)24(31)20(7)27(33)35-23)36-28-25(32)21(29(8)9)14-18(5)34-28/h11-12,15-21,23,25-26,28,32H,10,13-14H2,1-9H3/p+1/b12-11+/t15-,16-,17+,18-,19+,20-,21+,23-,25-,26+,28+/m1/s1 |
| InChIKey | OXFYAOOMMKGGAI-JLTOUBQASA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| narbomycin(1+) (CHEBI:76801) is a ammonium ion derivative (CHEBI:35274) |
| narbomycin(1+) (CHEBI:76801) is a organic cation (CHEBI:25697) |
| narbomycin(1+) (CHEBI:76801) is conjugate acid of narbomycin (CHEBI:29649) |
| Incoming Relation(s) |
| narbomycin (CHEBI:29649) is conjugate base of narbomycin(1+) (CHEBI:76801) |
| IUPAC Name |
|---|
| (3R,5R,6S,7S,9R,11E,13R,14R)-14-ethyl-3,5,7,9,13-pentamethyl-2,4,10-trioxooxacyclotetradec-11-en-6-yl 3,4,6-trideoxy-3-(dimethylazaniumyl)-β-D-xylo-hexopyranoside |
| Synonym | Source |
|---|---|
| narbomycin | SUBMITTER |
| UniProt Name | Source |
|---|---|
| narbomycin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-13834 | MetaCyc |