EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H5N3O2 |
| Net Charge | 0 |
| Average Mass | 139.114 |
| Monoisotopic Mass | 139.03818 |
| SMILES | [H]C(=O)c1cnc(=O)nc1N |
| InChI | InChI=1S/C5H5N3O2/c6-4-3(2-9)1-7-5(10)8-4/h1-2H,(H3,6,7,8,10) |
| InChIKey | FHSISDGOVSHJRW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-formylcytosine (CHEBI:76794) has functional parent cytosine (CHEBI:16040) |
| 5-formylcytosine (CHEBI:76794) has role metabolite (CHEBI:25212) |
| 5-formylcytosine (CHEBI:76794) is a aminopyrimidine (CHEBI:38338) |
| 5-formylcytosine (CHEBI:76794) is a heteroarenecarbaldehyde (CHEBI:49104) |
| 5-formylcytosine (CHEBI:76794) is a nucleobase analogue (CHEBI:67142) |
| 5-formylcytosine (CHEBI:76794) is a pyrimidone (CHEBI:38337) |
| IUPAC Name |
|---|
| 4-amino-2-oxo-1,2-dihydropyrimidine-5-carbaldehyde |
| Synonyms | Source |
|---|---|
| 4-amino-2-oxopyrimidine-5-carbaldehyde | ChEBI |
| cytosine-5-carbaldehyde | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7019680 | Reaxys |
| Citations |
|---|