EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H35NO3 |
| Net Charge | 0 |
| Average Mass | 289.460 |
| Monoisotopic Mass | 289.26169 |
| SMILES | CCCCCCCCCCCC[C@@H](O)[C@@H](O)[C@@H](N)CO |
| InChI | InChI=1S/C16H35NO3/c1-2-3-4-5-6-7-8-9-10-11-12-15(19)16(20)14(17)13-18/h14-16,18-20H,2-13,17H2,1H3/t14-,15+,16-/m0/s1 |
| InChIKey | OCHZTELGZBWSJD-XHSDSOJGSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| C16 phytosphingosine (CHEBI:76698) has functional parent hexadecasphing-4-enine (CHEBI:71052) |
| C16 phytosphingosine (CHEBI:76698) is a sphingoid (CHEBI:35785) |
| C16 phytosphingosine (CHEBI:76698) is conjugate base of C16 phytosphingosine(1+) (CHEBI:76699) |
| Incoming Relation(s) |
| N-[(2S,3S,4R)-1-(α-D-galactosyloxy)-3,4-dihydroxy-16-phenylhexadecan-2-yl]octanamide (CHEBI:139113) has functional parent C16 phytosphingosine (CHEBI:76698) |
| N-acylhexadecaphytosphingosine (CHEBI:82885) has functional parent C16 phytosphingosine (CHEBI:76698) |
| N-acylhexadecaphytosphingosine-1-phosphocholine (CHEBI:82898) has functional parent C16 phytosphingosine (CHEBI:76698) |
| C16 phytosphingosine(1+) (CHEBI:76699) is conjugate acid of C16 phytosphingosine (CHEBI:76698) |
| IUPAC Name |
|---|
| (2S,3S,4R)-2-aminohexadecane-1,3,4-triol |
| Synonyms | Source |
|---|---|
| (4R)-hydroxyhexadecasphinganine | SUBMITTER |
| hexadecaphytosphingosine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4230858 | Reaxys |