EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H31O3 |
| Net Charge | -1 |
| Average Mass | 271.421 |
| Monoisotopic Mass | 271.22787 |
| SMILES | CCCCCCCCCCCCCC(O)CC(=O)[O-] |
| InChI | InChI=1S/C16H32O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-15(17)14-16(18)19/h15,17H,2-14H2,1H3,(H,18,19)/p-1 |
| InChIKey | CBWALJHXHCJYTE-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxypalmitate (CHEBI:76613) has functional parent hexadecanoate (CHEBI:7896) |
| 3-hydroxypalmitate (CHEBI:76613) is a 3-hydroxy fatty acid anion (CHEBI:84196) |
| 3-hydroxypalmitate (CHEBI:76613) is a long-chain fatty acid anion (CHEBI:57560) |
| 3-hydroxypalmitate (CHEBI:76613) is conjugate base of 3-hydroxypalmitic acid (CHEBI:37248) |
| Incoming Relation(s) |
| 3-hydroxypalmitic acid (CHEBI:37248) is conjugate acid of 3-hydroxypalmitate (CHEBI:76613) |
| IUPAC Name |
|---|
| 3-hydroxyhexadecanoate |
| Synonyms | Source |
|---|---|
| β-hydroxyhexadecanoate | ChEBI |
| 3-OH-C16:0(1−) | SUBMITTER |
| β-hydroxypalmitate | ChEBI |
| UniProt Name | Source |
|---|---|
| 3-hydroxyhexadecanoate | UniProt |