EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H24N6O2 |
| Net Charge | 0 |
| Average Mass | 440.507 |
| Monoisotopic Mass | 440.19607 |
| SMILES | C=CC(=O)N1CCC[C@@H](n2nc(-c3ccc(Oc4ccccc4)cc3)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C25H24N6O2/c1-2-21(32)30-14-6-7-18(15-30)31-25-22(24(26)27-16-28-25)23(29-31)17-10-12-20(13-11-17)33-19-8-4-3-5-9-19/h2-5,8-13,16,18H,1,6-7,14-15H2,(H2,26,27,28)/t18-/m1/s1 |
| InChIKey | XYFPWWZEPKGCCK-GOSISDBHSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that specifically blocks the action of non-specific protein-tyrosine kinase (EC 2.7.10.2). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ibrutinib (CHEBI:76612) has role antineoplastic agent (CHEBI:35610) |
| ibrutinib (CHEBI:76612) has role EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor (CHEBI:76617) |
| ibrutinib (CHEBI:76612) is a N-acylpiperidine (CHEBI:48591) |
| ibrutinib (CHEBI:76612) is a acrylamides (CHEBI:22216) |
| ibrutinib (CHEBI:76612) is a aromatic amine (CHEBI:33860) |
| ibrutinib (CHEBI:76612) is a aromatic ether (CHEBI:35618) |
| ibrutinib (CHEBI:76612) is a pyrazolopyrimidine (CHEBI:38669) |
| ibrutinib (CHEBI:76612) is a tertiary carboxamide (CHEBI:140326) |
| IUPAC Name |
|---|
| 1-{(3R)-3-[4-amino-3-(4-phenoxyphenyl)-1H-pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl}prop-2-en-1-one |
| INNs | Source |
|---|---|
| ibrutinib | WHO MedNet |
| ibrutinib | WHO MedNet |
| ibrutinib | WHO MedNet |
| ibrutinibum | WHO MedNet |
| Synonyms | Source |
|---|---|
| PCI 32765 | ChemIDplus |
| PCI-32765 | ChemIDplus |
| PCI32765 | ChemIDplus |
| Brand Name | Source |
|---|---|
| IMBRUVICA | KEGG DRUG |
| UniProt Name | Source |
|---|---|
| ibrutinib | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 4810 | DrugCentral |
| D10223 | KEGG DRUG |
| Ibrutinib | Wikipedia |
| US2008076921 | Patent |
| US2012053189 | Patent |
| US20130178483 | Patent |
| US2013079327 | Patent |
| US2013178483 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:13102252 | Reaxys |
| CAS:936563-96-1 | KEGG DRUG |
| CAS:936563-96-1 | ChemIDplus |
| Citations |
|---|