EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H4Cl6O4 |
| Net Charge | 0 |
| Average Mass | 388.845 |
| Monoisotopic Mass | 385.82407 |
| SMILES | O=C(O)C1C(C(=O)O)C2(Cl)C(Cl)=C(Cl)C1(Cl)C2(Cl)Cl |
| InChI | InChI=1S/C9H4Cl6O4/c10-3-4(11)8(13)2(6(18)19)1(5(16)17)7(3,12)9(8,14)15/h1-2H,(H,16,17)(H,18,19) |
| InChIKey | DJKGDNKYTKCJKD-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorendic acid (CHEBI:76603) has role carcinogenic agent (CHEBI:50903) |
| chlorendic acid (CHEBI:76603) is a bridged compound (CHEBI:35990) |
| chlorendic acid (CHEBI:76603) is a dicarboxylic acid (CHEBI:35692) |
| chlorendic acid (CHEBI:76603) is a organochlorine compound (CHEBI:36683) |
| IUPAC Name |
|---|
| 1,4,5,6,7,7-hexachlorobicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid |
| Synonyms | Source |
|---|---|
| 1,4,5,6,7,7-Hexachloro-5-norbornene-2,3-dicarboxylic acid | KEGG COMPOUND |
| 1,4,5,6,7,7-Hexachloro-5-norbornene-2,3-dicarboxylic acid | ChemIDplus |
| 1,4,5,6,7,7-Hexachlorobicyclo(2.2.1)-5-heptene-2,3-dicarboxylic acid | ChemIDplus |
| Chlorendic acid | KEGG COMPOUND |
| Hexachloro-endo-methylenetetrahydrophthalic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C19204 | KEGG COMPOUND |
| Chlorendic_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1892213 | Reaxys |
| Reaxys:8156979 | Reaxys |
| CAS:115-28-6 | KEGG COMPOUND |
| CAS:115-28-6 | ChemIDplus |
| Citations |
|---|