EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H5NO2 |
| Net Charge | 0 |
| Average Mass | 87.078 |
| Monoisotopic Mass | 87.03203 |
| SMILES | C=C([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C3H5NO2/c1-2(4)3(5)6/h1,4H2,(H,5,6) |
| InChIKey | UQBOJOOOTLPNST-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-ammonioprop-2-enoate (CHEBI:76565) is a amino-acid zwitterion (CHEBI:35238) |
| 2-ammonioprop-2-enoate (CHEBI:76565) is tautomer of 2-aminoacrylic acid (CHEBI:17123) |
| 2-ammonioprop-2-enoate (CHEBI:76565) is tautomer of 2-iminiopropionate (CHEBI:44400) |
| 2-ammonioprop-2-enoate (CHEBI:76565) is tautomer of 2-iminopropionic acid (CHEBI:76608) |
| Incoming Relation(s) |
| 2-aminoacrylic acid (CHEBI:17123) is tautomer of 2-ammonioprop-2-enoate (CHEBI:76565) |
| 2-iminiopropionate (CHEBI:44400) is tautomer of 2-ammonioprop-2-enoate (CHEBI:76565) |
| 2-iminopropionic acid (CHEBI:76608) is tautomer of 2-ammonioprop-2-enoate (CHEBI:76565) |
| UniProt Name | Source |
|---|---|
| 2-aminoprop-2-enoate | UniProt |
| Citations |
|---|