EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H50N7O20P3S |
| Net Charge | 0 |
| Average Mass | 965.759 |
| Monoisotopic Mass | 965.20442 |
| SMILES | CC(C)(COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O)[C@@H](O)C(=O)NCCC(=O)NCCSC(=O)CC(=O)CCCCCCC(=O)O |
| InChI | InChI=1S/C31H50N7O20P3S/c1-31(2,26(45)29(46)34-10-9-20(40)33-11-12-62-22(43)13-18(39)7-5-3-4-6-8-21(41)42)15-55-61(52,53)58-60(50,51)54-14-19-25(57-59(47,48)49)24(44)30(56-19)38-17-37-23-27(32)35-16-36-28(23)38/h16-17,19,24-26,30,44-45H,3-15H2,1-2H3,(H,33,40)(H,34,46)(H,41,42)(H,50,51)(H,52,53)(H2,32,35,36)(H2,47,48,49)/t19-,24-,25-,26+,30-/m1/s1 |
| InChIKey | KWGOAMVVCDRMMC-PVMJKYSESA-N |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-oxodecanedioyl-CoA (CHEBI:76445) is a acyl-CoA (CHEBI:17984) |
| 3-oxodecanedioyl-CoA (CHEBI:76445) is conjugate acid of 3-oxodecanedioyl-CoA(5−) (CHEBI:76349) |
| Incoming Relation(s) |
| 3-oxodecanedioyl-CoA(5−) (CHEBI:76349) is conjugate base of 3-oxodecanedioyl-CoA (CHEBI:76445) |
| IUPAC Name |
|---|
| 3'-phosphoadenosine 5'-{3-[(3R)-4-({3-[(2-{[9-carboxy-3-oxononanoyl]sulfanyl}ethyl)amino]-3-oxopropyl}amino)-3-hydroxy-2,2-dimethyl-4-oxobutyl] dihydrogen diphosphate} |
| Synonyms | Source |
|---|---|
| 3-ketodecanedioyl-CoA | ChEBI |
| 3-ketodecanedioyl-coenzyme A | ChEBI |
| 3-oxodecanedioyl-coenzyme A | ChEBI |