EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H46N7O20P3S |
| Net Charge | 0 |
| Average Mass | 937.705 |
| Monoisotopic Mass | 937.17312 |
| SMILES | CC(C)(COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O)[C@@H](O)C(=O)NCCC(=O)NCCSC(=O)CC(=O)CCCCC(=O)O |
| InChI | InChI=1S/C29H46N7O20P3S/c1-29(2,24(43)27(44)32-8-7-18(38)31-9-10-60-20(41)11-16(37)5-3-4-6-19(39)40)13-53-59(50,51)56-58(48,49)52-12-17-23(55-57(45,46)47)22(42)28(54-17)36-15-35-21-25(30)33-14-34-26(21)36/h14-15,17,22-24,28,42-43H,3-13H2,1-2H3,(H,31,38)(H,32,44)(H,39,40)(H,48,49)(H,50,51)(H2,30,33,34)(H2,45,46,47)/t17-,22-,23-,24+,28-/m1/s1 |
| InChIKey | YBYNWPGFFKQFTA-NOQDIWQESA-N |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-oxooctanedioyl-CoA (CHEBI:76426) is a acyl-CoA (CHEBI:17984) |
| 3-oxooctanedioyl-CoA (CHEBI:76426) is conjugate acid of 3-oxooctanedioyl-CoA(5−) (CHEBI:76335) |
| Incoming Relation(s) |
| 3-oxooctanedioyl-CoA(5−) (CHEBI:76335) is conjugate base of 3-oxooctanedioyl-CoA (CHEBI:76426) |
| IUPAC Name |
|---|
| 3'-phosphoadenosine 5'-{3-[(3R)-4-({3-[(2-{[7-carboxy-3-oxoheptanoyl]sulfanyl}ethyl)amino]-3-oxopropyl}amino)-3-hydroxy-2,2-dimethyl-4-oxobutyl] dihydrogen diphosphate} |
| Synonyms | Source |
|---|---|
| 3-ketooctanedioyl-CoA | ChEBI |
| 3-ketooctanedioyl-coenzyme A | ChEBI |
| 3-ketosuberyl-CoA | ChEBI |
| 3-ketosuberyl-coenzyme A | ChEBI |
| 3-oxooctanedioyl-coenzyme A | ChEBI |
| 3-oxosuberyl-CoA | ChEBI |