EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H46N7O19P3S |
| Net Charge | 0 |
| Average Mass | 921.706 |
| Monoisotopic Mass | 921.17820 |
| SMILES | CC(C)(COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O)[C@@H](O)C(=O)NCCC(=O)NCCSC(=O)/C=C/CCCCC(=O)O |
| InChI | InChI=1S/C29H46N7O19P3S/c1-29(2,24(42)27(43)32-10-9-18(37)31-11-12-59-20(40)8-6-4-3-5-7-19(38)39)14-52-58(49,50)55-57(47,48)51-13-17-23(54-56(44,45)46)22(41)28(53-17)36-16-35-21-25(30)33-15-34-26(21)36/h6,8,15-17,22-24,28,41-42H,3-5,7,9-14H2,1-2H3,(H,31,37)(H,32,43)(H,38,39)(H,47,48)(H,49,50)(H2,30,33,34)(H2,44,45,46)/b8-6+/t17-,22-,23-,24+,28-/m1/s1 |
| InChIKey | UUCJVAJRAMBJMP-WBKFOJBMSA-N |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-2-octenedioyl-CoA (CHEBI:76423) is a acyl-CoA (CHEBI:17984) |
| trans-2-octenedioyl-CoA (CHEBI:76423) is conjugate acid of trans-2-octenedioyl-CoA(5−) (CHEBI:76330) |
| Incoming Relation(s) |
| trans-2-octenedioyl-CoA(5−) (CHEBI:76330) is conjugate base of trans-2-octenedioyl-CoA (CHEBI:76423) |
| IUPAC Name |
|---|
| 3'-phosphoadenosine 5'-{3-[(3R)-4-({3-[(2-{[(2E)-7-carboxyhept-2-enoyl]sulfanyl}ethyl)amino]-3-oxopropyl}amino)-3-hydroxy-2,2-dimethyl-4-oxobutyl] dihydrogen diphosphate} |
| Synonyms | Source |
|---|---|
| (E)-2-octenedioyl-coenzyme A | ChEBI |
| trans-2-octenedioyl-coenzyme A | ChEBI |
| (E)-2-octenedioyl-CoA | ChEBI |