EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10O5 |
| Net Charge | 0 |
| Average Mass | 270.240 |
| Monoisotopic Mass | 270.05282 |
| SMILES | O=c1cc(-c2ccccc2)oc2c(O)c(O)cc(O)c12 |
| InChI | InChI=1S/C15H10O5/c16-9-6-11(18)14(19)15-13(9)10(17)7-12(20-15)8-4-2-1-3-5-8/h1-7,16,18-19H |
| InChIKey | ZFKKRRMUPBBYRS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| norwogonin (CHEBI:7642) has role antioxidant (CHEBI:22586) |
| norwogonin (CHEBI:7642) has role metabolite (CHEBI:25212) |
| norwogonin (CHEBI:7642) is a trihydroxyflavone (CHEBI:27116) |
| IUPAC Name |
|---|
| 5,7,8-trihydroxy-2-phenyl-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| Norwogonin | KEGG COMPOUND |
| 5,7,8-Trihydroxyflavone | KEGG COMPOUND |
| 2-Phenyl-5,7,8-trihydroxy-4H-1-benzopyran-4-one | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C10113 | KEGG COMPOUND |
| LMPK12111329 | LIPID MAPS |
| C00001077 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:272168 | Reaxys |
| CAS:4443-09-8 | KEGG COMPOUND |
| CAS:4443-09-8 | ChemIDplus |
| Citations |
|---|