EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21N.HCl |
| Net Charge | 0 |
| Average Mass | 299.845 |
| Monoisotopic Mass | 299.14408 |
| SMILES | CNCCC=C1c2ccccc2CCc2ccccc21.Cl |
| InChI | InChI=1S/C19H21N.ClH/c1-20-14-6-11-19-17-9-4-2-7-15(17)12-13-16-8-3-5-10-18(16)19;/h2-5,7-11,20H,6,12-14H2,1H3;1H |
| InChIKey | SHAYBENGXDALFF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. gastrointestinal drug A drug used for its effects on the gastrointestinal system, e.g. controlling gastric acidity, regulating gastrointestinal motility and water flow, and improving digestion. dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. antipsoriatic A drug used to treat psoriasis. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nortriptyline hydrochloride (CHEBI:7641) has role antidepressant (CHEBI:35469) |
| Nortriptyline hydrochloride (CHEBI:7641) has role antineoplastic agent (CHEBI:35610) |
| Nortriptyline hydrochloride (CHEBI:7641) has role antipsoriatic (CHEBI:50748) |
| Nortriptyline hydrochloride (CHEBI:7641) has role dermatologic drug (CHEBI:50177) |
| Nortriptyline hydrochloride (CHEBI:7641) has role gastrointestinal drug (CHEBI:55324) |
| Nortriptyline hydrochloride (CHEBI:7641) has role geroprotector (CHEBI:176497) |
| Nortriptyline hydrochloride (CHEBI:7641) is a organic tricyclic compound (CHEBI:51959) |
| Synonyms | Source |
|---|---|
| 38489 | ChEMBL |
| Nortriptyline hydrochloride | KEGG COMPOUND |
| NSC-169453 | ChEMBL |
| Pamelor | KEGG COMPOUND |
| Brand Name | Source |
|---|---|
| Aventyl hydrochloride | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| C07983 | KEGG COMPOUND |
| D00816 | KEGG DRUG |
| DBSALT000641 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:894-71-3 | ChemIDplus |
| Citations |
|---|