EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H8O6 |
| Net Charge | 0 |
| Average Mass | 260.201 |
| Monoisotopic Mass | 260.03209 |
| SMILES | O=c1c2c(O)cc(O)cc2oc2ccc(O)c(O)c12 |
| InChI | InChI=1S/C13H8O6/c14-5-3-7(16)10-9(4-5)19-8-2-1-6(15)12(17)11(8)13(10)18/h1-4,14-17H |
| InChIKey | RVOUOPDWADMVBA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Gentiana bavarica (ncbitaxon:49937) | - | DOI (10.1016/S0031-9422(00)00303-4) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| norswertianin (CHEBI:7637) has role plant metabolite (CHEBI:76924) |
| norswertianin (CHEBI:7637) is a polyphenol (CHEBI:26195) |
| norswertianin (CHEBI:7637) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| 1,2,6,8-tetrahydroxy-9H-xanthen-9-one |
| Synonym | Source |
|---|---|
| 1,2,6,8-Tetrahydroxyxanthone | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:270047 | Reaxys |
| CAS:22172-15-2 | KEGG COMPOUND |
| CAS:22172-15-2 | ChemIDplus |