EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H52N7O19P3S |
| Net Charge | 0 |
| Average Mass | 951.776 |
| Monoisotopic Mass | 951.22515 |
| SMILES | CC(C)(COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O)[C@@H](O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCCC(=O)O |
| InChI | InChI=1S/C31H52N7O19P3S/c1-31(2,26(44)29(45)34-12-11-20(39)33-13-14-61-22(42)10-8-6-4-3-5-7-9-21(40)41)16-54-60(51,52)57-59(49,50)53-15-19-25(56-58(46,47)48)24(43)30(55-19)38-18-37-23-27(32)35-17-36-28(23)38/h17-19,24-26,30,43-44H,3-16H2,1-2H3,(H,33,39)(H,34,45)(H,40,41)(H,49,50)(H,51,52)(H2,32,35,36)(H2,46,47,48)/t19-,24-,25-,26+,30-/m1/s1 |
| InChIKey | JZXNELIZHJCEFA-PVMJKYSESA-N |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| decanedioyl-CoA (CHEBI:76345) has functional parent sebacic acid (CHEBI:41865) |
| decanedioyl-CoA (CHEBI:76345) is a ω-carboxyacyl-CoA (CHEBI:37555) |
| decanedioyl-CoA (CHEBI:76345) is conjugate acid of decanedioyl-CoA(5−) (CHEBI:76316) |
| Incoming Relation(s) |
| decanedioyl-CoA(5−) (CHEBI:76316) is conjugate base of decanedioyl-CoA (CHEBI:76345) |
| IUPAC Name |
|---|
| 3'-phosphoadenosine 5'-{3-[(3R)-4-{[3-({2-[(3-carboxynonanoyl)sulfanyl]ethyl}amino)-3-oxopropyl]amino}-3-hydroxy-2,2-dimethyl-4-oxobutyl] dihydrogen diphosphate} |
| Synonyms | Source |
|---|---|
| 9-carboxynonanoyl-CoA | ChEBI |
| 9-carboxynonanoyl-coenzyme A | ChEBI |
| decanedioyl-coenzyme A | ChEBI |
| sebacoyl-CoA | ChEBI |
| sebacoyl-coenzyme A | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8535273 | Reaxys |