EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H13NO |
| Net Charge | 0 |
| Average Mass | 223.275 |
| Monoisotopic Mass | 223.09971 |
| SMILES | CC(=O)Nc1cccc2c1-c1ccccc1C2 |
| InChI | InChI=1S/C15H13NO/c1-10(17)16-14-8-4-6-12-9-11-5-2-3-7-13(11)15(12)14/h2-8H,9H2,1H3,(H,16,17) |
| InChIKey | PHPWISAFHNEMSR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | mitogen A chemical substance that encourages a cell to commence cell division, triggering mitosis. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-acetylaminofluorene (CHEBI:76343) has role mitogen (CHEBI:52290) |
| 4-acetylaminofluorene (CHEBI:76343) is a acetamides (CHEBI:22160) |
| 4-acetylaminofluorene (CHEBI:76343) is a fluorenes (CHEBI:24059) |
| IUPAC Name |
|---|
| N-(9H-fluoren-4-yl)acetamide |
| Synonyms | Source |
|---|---|
| N-fluoren-4-ylacetamide | ChemIDplus |
| N-9H-fluoren-4-ylacetamide | ChemIDplus |
| 4-Acetylaminofluoren | ChemIDplus |
| 4-fluorenylacetamide | ChemIDplus |
| N-4-fluorenylacetamide | NIST Chemistry WebBook |
| 4-AAF | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2975269 | Reaxys |
| CAS:28322-02-3 | ChemIDplus |
| CAS:28322-02-3 | NIST Chemistry WebBook |
| Citations |
|---|