EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H50O4 |
| Net Charge | 0 |
| Average Mass | 426.682 |
| Monoisotopic Mass | 426.37091 |
| SMILES | O=C(O)CCCCCCCCCCCCCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C26H50O4/c27-25(28)23-21-19-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18-20-22-24-26(29)30/h1-24H2,(H,27,28)(H,29,30) |
| InChIKey | JJWZFUFNJNGKAF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hexacosanedioic acid (CHEBI:76334) has parent hydride hexacosane (CHEBI:32940) |
| hexacosanedioic acid (CHEBI:76334) is a dicarboxylic fatty acid (CHEBI:189840) |
| hexacosanedioic acid (CHEBI:76334) is a α,ω-dicarboxylic acid (CHEBI:28383) |
| hexacosanedioic acid (CHEBI:76334) is conjugate acid of hexacosanedioate(2−) (CHEBI:76312) |
| Incoming Relation(s) |
| hexacosanedioate(2−) (CHEBI:76312) is conjugate base of hexacosanedioic acid (CHEBI:76334) |
| IUPAC Name |
|---|
| hexacosanedioic acid |
| Manual Xrefs | Databases |
|---|---|
| LMFA01170040 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1805140 | Reaxys |