EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H50O3 |
| Net Charge | 0 |
| Average Mass | 410.683 |
| Monoisotopic Mass | 410.37600 |
| SMILES | O=CCCCCCCCCCCCCCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C26H50O3/c27-25-23-21-19-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18-20-22-24-26(28)29/h25H,1-24H2,(H,28,29) |
| InChIKey | UWQBXHRRMZPENW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 26-oxohexacosanoic acid (CHEBI:76332) has functional parent hexacosanoic acid (CHEBI:31009) |
| 26-oxohexacosanoic acid (CHEBI:76332) is a aldehydic acid (CHEBI:26643) |
| 26-oxohexacosanoic acid (CHEBI:76332) is a very long-chain fatty acid (CHEBI:27283) |
| 26-oxohexacosanoic acid (CHEBI:76332) is a ω-oxo fatty acid (CHEBI:76328) |
| 26-oxohexacosanoic acid (CHEBI:76332) is conjugate acid of 26-oxohexacosanoate (CHEBI:76311) |
| Incoming Relation(s) |
| 26-oxohexacosanoate (CHEBI:76311) is conjugate base of 26-oxohexacosanoic acid (CHEBI:76332) |
| IUPAC Name |
|---|
| 26-oxohexacosanoic acid |
| Synonyms | Source |
|---|---|
| 26-ketocerotic acid | ChEBI |
| 26-ketohexacosanoic acid | ChEBI |
| 26-oxocerotic acid | ChEBI |
| ω-ketocerotic acid | ChEBI |
| ω-ketohexacosanoic acid | ChEBI |
| ω-oxocerotic acid | ChEBI |