EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H15NO3 |
| Net Charge | 0 |
| Average Mass | 281.311 |
| Monoisotopic Mass | 281.10519 |
| SMILES | CC(=O)ON(C(C)=O)c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C17H15NO3/c1-11(19)18(21-12(2)20)15-7-8-17-14(10-15)9-13-5-3-4-6-16(13)17/h3-8,10H,9H2,1-2H3 |
| InChIKey | NFOMHWALMFWNAQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetoxy-2-acetamidofluorene (CHEBI:76331) has role carcinogenic agent (CHEBI:50903) |
| N-acetoxy-2-acetamidofluorene (CHEBI:76331) has role mutagen (CHEBI:25435) |
| N-acetoxy-2-acetamidofluorene (CHEBI:76331) is a 2-acetamidofluorenes (CHEBI:19432) |
| IUPAC Name |
|---|
| N-acetyloxy-N-(9H-fluoren-2-yl)acetamide |
| Synonyms | Source |
|---|---|
| 2-Acetoxyacetylaminofluorene | ChemIDplus |
| Acetic acid, ester with N-(fluoren-2-yl)acetohydroxamic acid | ChemIDplus |
| Acetic acid, (N-acetyl-N-(2-fluorenyl)amino) ester | ChemIDplus |
| Acetoxy AAF | ChemIDplus |
| Acetoxyacetylaminofluorene | ChemIDplus |
| NA-AAF | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2222410 | Reaxys |
| CAS:6098-44-8 | ChemIDplus |
| Citations |
|---|