EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H15NO3 |
| Net Charge | 0 |
| Average Mass | 281.311 |
| Monoisotopic Mass | 281.10519 |
| SMILES | CC(=O)ON(C(C)=O)c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C17H15NO3/c1-11(19)18(21-12(2)20)15-7-8-17-14(10-15)9-13-5-3-4-6-16(13)17/h3-8,10H,9H2,1-2H3 |
| InChIKey | NFOMHWALMFWNAQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetoxy-2-acetamidofluorene (CHEBI:76331) has role carcinogenic agent (CHEBI:50903) |
| N-acetoxy-2-acetamidofluorene (CHEBI:76331) has role mutagen (CHEBI:25435) |
| N-acetoxy-2-acetamidofluorene (CHEBI:76331) is a 2-acetamidofluorenes (CHEBI:19432) |
| IUPAC Name |
|---|
| N-acetyloxy-N-(9H-fluoren-2-yl)acetamide |
| Synonyms | Source |
|---|---|
| 2-Acetoxyacetylaminofluorene | ChemIDplus |
| Acetic acid, ester with N-(fluoren-2-yl)acetohydroxamic acid | ChemIDplus |
| Acetic acid, (N-acetyl-N-(2-fluorenyl)amino) ester | ChemIDplus |
| Acetoxy AAF | ChemIDplus |
| Acetoxyacetylaminofluorene | ChemIDplus |
| NA-AAF | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2222410 | Reaxys |
| CAS:6098-44-8 | ChemIDplus |
| Citations |
|---|