EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H17N3 |
| Net Charge | 0 |
| Average Mass | 239.322 |
| Monoisotopic Mass | 239.14225 |
| SMILES | Cc1cccc(/N=N/c2ccc(N(C)C)cc2)c1 |
| InChI | InChI=1S/C15H17N3/c1-12-5-4-6-14(11-12)17-16-13-7-9-15(10-8-13)18(2)3/h4-11H,1-3H3/b17-16+ |
| InChIKey | LVTFSVIRYMXRSR-WUKNDPDISA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-methyl-4'-dimethylaminoazobenzene (CHEBI:76329) has role carcinogenic agent (CHEBI:50903) |
| 3-methyl-4'-dimethylaminoazobenzene (CHEBI:76329) is a azobenzenes (CHEBI:22682) |
| 3-methyl-4'-dimethylaminoazobenzene (CHEBI:76329) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N,N-dimethyl-4-[(E)-(3-methylphenyl)diazenyl]aniline |
| Synonyms | Source |
|---|---|
| 3'-Mdab | ChemIDplus |
| 3',N,N-trimethyl-4-aminoazobenzene | ChemIDplus |
| N,N-dimethyl-p-(m-tolylazo)aniline | ChemIDplus |
| 4-dimethylamino-3'-methylazobenzene | ChemIDplus |
| 3'-methyl-4-(dimethylamino)azobenzene | ChEBI |
| 4-(N,N-dimethylamino)-3'-methylazobenzene | ChemIDplus |
| Citations |
|---|