EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H52O3 |
| Net Charge | 0 |
| Average Mass | 412.699 |
| Monoisotopic Mass | 412.39165 |
| SMILES | O=C(O)CCCCCCCCCCCCCCCCCCCCCCCCCO |
| InChI | InChI=1S/C26H52O3/c27-25-23-21-19-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18-20-22-24-26(28)29/h27H,1-25H2,(H,28,29) |
| InChIKey | GGDUSUKUCOFETL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 26-hydroxyhexacosanoic acid (CHEBI:76325) has functional parent hexacosanoic acid (CHEBI:31009) |
| 26-hydroxyhexacosanoic acid (CHEBI:76325) has role metabolite (CHEBI:25212) |
| 26-hydroxyhexacosanoic acid (CHEBI:76325) is a ω-hydroxy-very-long-chain fatty acid (CHEBI:194304) |
| 26-hydroxyhexacosanoic acid (CHEBI:76325) is conjugate acid of 26-hydroxyhexacosanoate (CHEBI:76305) |
| Incoming Relation(s) |
| 26-hydroxyhexacosanoate (CHEBI:76305) is conjugate base of 26-hydroxyhexacosanoic acid (CHEBI:76325) |
| IUPAC Name |
|---|
| 26-hydroxyhexacosanoic acid |
| Synonyms | Source |
|---|---|
| 26-hydroxycerotic acid | ChEBI |
| ω-hydroxycerotic acid | ChEBI |
| ω-hydroxyhexacosanoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01050219 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1914869 | Reaxys |