EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H18O5 |
| Net Charge | 0 |
| Average Mass | 314.337 |
| Monoisotopic Mass | 314.11542 |
| SMILES | COc1ccc([C@@H]2CC(=O)c3c(O)c(C)c(O)c(C)c3O2)cc1 |
| InChI | InChI=1S/C18H18O5/c1-9-16(20)10(2)18-15(17(9)21)13(19)8-14(23-18)11-4-6-12(22-3)7-5-11/h4-7,14,20-21H,8H2,1-3H3/t14-/m0/s1 |
| InChIKey | DZTRDRPCROOSOG-AWEZNQCLSA-N |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| matteucinol (CHEBI:76323) has functional parent (2S)-flavanone (CHEBI:15606) |
| matteucinol (CHEBI:76323) has role plant metabolite (CHEBI:76924) |
| matteucinol (CHEBI:76323) has role radical scavenger (CHEBI:48578) |
| matteucinol (CHEBI:76323) is a 4'-methoxyflavanones (CHEBI:140332) |
| matteucinol (CHEBI:76323) is a dihydroxyflavanone (CHEBI:38749) |
| matteucinol (CHEBI:76323) is a monomethoxyflavanone (CHEBI:38738) |
| Incoming Relation(s) |
| (2S)-2'-hydroxydemethoxymatteucinol (CHEBI:67371) has functional parent matteucinol (CHEBI:76323) |
| IUPAC Name |
|---|
| (2S)-5,7-dihydroxy-2-(4-methoxyphenyl)-6,8-dimethyl-2,3-dihydro-4H-chromen-4-one |
| Synonym | Source |
|---|---|
| (2S)-5,7-dihydroxy-4'-methoxy-6,8-dimethylflavanone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMPK12140351 | LIPID MAPS |
| JP2002173424 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:37152 | Reaxys |
| CAS:489-38-3 | ChemIDplus |
| Citations |
|---|