EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H44O3 |
| Net Charge | 0 |
| Average Mass | 356.591 |
| Monoisotopic Mass | 356.32905 |
| SMILES | O=C(O)CCCCCCCCCCCCCCCCCCCCCO |
| InChI | InChI=1S/C22H44O3/c23-21-19-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18-20-22(24)25/h23H,1-21H2,(H,24,25) |
| InChIKey | IBPVZXPSTLXWCG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 22-hydroxydocosanoic acid (CHEBI:76322) has functional parent docosanoic acid (CHEBI:28941) |
| 22-hydroxydocosanoic acid (CHEBI:76322) has role metabolite (CHEBI:25212) |
| 22-hydroxydocosanoic acid (CHEBI:76322) is a ω-hydroxy-long-chain fatty acid (CHEBI:140997) |
| 22-hydroxydocosanoic acid (CHEBI:76322) is conjugate acid of 22-hydroxydocosanoate (CHEBI:76304) |
| Incoming Relation(s) |
| 22-hydroxydocosanoate (CHEBI:76304) is conjugate base of 22-hydroxydocosanoic acid (CHEBI:76322) |
| IUPAC Name |
|---|
| 22-hydroxydocosanoic acid |
| Synonyms | Source |
|---|---|
| 22-hydroxybehenic acid | ChEBI |
| phellonic acid | MetaCyc |
| ω-hydroxybehenic acid | ChEBI |
| ω-hydroxydocosanoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C19623 | KEGG COMPOUND |
| CPD-7838 | MetaCyc |
| LMFA01050079 | LIPID MAPS |
| WO2007121482 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1796845 | Reaxys |
| Citations |
|---|