EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H42O3 |
| Net Charge | 0 |
| Average Mass | 354.575 |
| Monoisotopic Mass | 354.31340 |
| SMILES | O=CCCCCCCCCCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C22H42O3/c23-21-19-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18-20-22(24)25/h21H,1-20H2,(H,24,25) |
| InChIKey | PYBWSGBQPKXKOQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 22-oxodocosanoic acid (CHEBI:76318) has functional parent docosanoic acid (CHEBI:28941) |
| 22-oxodocosanoic acid (CHEBI:76318) is a aldehydic acid (CHEBI:26643) |
| 22-oxodocosanoic acid (CHEBI:76318) is a long-chain fatty acid (CHEBI:15904) |
| 22-oxodocosanoic acid (CHEBI:76318) is a ω-oxo fatty acid (CHEBI:76328) |
| 22-oxodocosanoic acid (CHEBI:76318) is conjugate acid of 22-oxodocosanoate (CHEBI:76298) |
| Incoming Relation(s) |
| 22-oxodocosanoate (CHEBI:76298) is conjugate base of 22-oxodocosanoic acid (CHEBI:76318) |
| IUPAC Name |
|---|
| 22-oxodocosanoic acid |
| Synonyms | Source |
|---|---|
| 22-ketobehenic acid | ChEBI |
| 22-ketodocosanoic acid | ChEBI |
| 22-oxobehenic acid | ChEBI |
| ω-ketobehenic acid | ChEBI |
| ω-ketodocosanoic acid | ChEBI |
| ω-oxobehenic acid | ChEBI |