EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H21NO3 |
| Net Charge | 0 |
| Average Mass | 275.348 |
| Monoisotopic Mass | 275.15214 |
| SMILES | O=C(OC1CC2CCC(C1)N2)[C@H](CO)c1ccccc1 |
| InChI | InChI=1S/C16H21NO3/c18-10-15(11-4-2-1-3-5-11)16(19)20-14-8-12-6-7-13(9-14)17-12/h1-5,12-15,17-18H,6-10H2/t12?,13?,14?,15-/m1/s1 |
| InChIKey | ATKYNAZQGVYHIB-MLGYPOCJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Norhyoscyamine (CHEBI:7631) is a monocarboxylic acid (CHEBI:25384) |
| Synonym | Source |
|---|---|
| Norhyoscyamine | KEGG COMPOUND |