EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H14O12P2 |
| Net Charge | 0 |
| Average Mass | 340.114 |
| Monoisotopic Mass | 339.99605 |
| SMILES | O=P(O)(O)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H14O12P2/c7-1-2(8)5(17-19(11,12)13)4(10)6(3(1)9)18-20(14,15)16/h1-10H,(H2,11,12,13)(H2,14,15,16)/t1-,2-,3-,4-,5+,6-/m0/s1 |
| InChIKey | PUVHMWJJTITUGO-ZSIQDKGESA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1D-myo-inositol 3,5-bisphosphate (CHEBI:76303) is a myo-inositol bisphosphate (CHEBI:25443) |
| 1D-myo-inositol 3,5-bisphosphate (CHEBI:76303) is conjugate acid of 1D-myo-inositol 3,5-bisphosphate(4−) (CHEBI:76296) |
| Incoming Relation(s) |
| 1D-myo-inositol 3,5-bisphosphate(4−) (CHEBI:76296) is conjugate base of 1D-myo-inositol 3,5-bisphosphate (CHEBI:76303) |
| IUPAC Name |
|---|
| 1D-myo-inositol 3,5-bis(dihydrogen phosphate) |
| Synonym | Source |
|---|---|
| (1R,2S,3S,4S,5S,6S)-2,4,5,6-tetrahydroxycyclohexane-1,3-diyl bis[dihydrogen (phosphate)] | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11180681 | Reaxys |
| Citations |
|---|