EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18O10 |
| Net Charge | 0 |
| Average Mass | 418.354 |
| Monoisotopic Mass | 418.09000 |
| SMILES | O=c1c(O[C@@H]2OC[C@@H](O)[C@H](O)[C@H]2O)c(-c2ccc(O)cc2)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C20H18O10/c21-9-3-1-8(2-4-9)18-19(30-20-17(27)15(25)12(24)7-28-20)16(26)14-11(23)5-10(22)6-13(14)29-18/h1-6,12,15,17,20-25,27H,7H2/t12-,15+,17-,20+/m1/s1 |
| InChIKey | RNVUDWOQYYWXBJ-BWYUNELBSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kaempferol 3-O-β-D-xyloside (CHEBI:76294) has functional parent kaempferol (CHEBI:28499) |
| kaempferol 3-O-β-D-xyloside (CHEBI:76294) has role metabolite (CHEBI:25212) |
| kaempferol 3-O-β-D-xyloside (CHEBI:76294) is a glycosyloxyflavone (CHEBI:50018) |
| kaempferol 3-O-β-D-xyloside (CHEBI:76294) is a monosaccharide derivative (CHEBI:63367) |
| kaempferol 3-O-β-D-xyloside (CHEBI:76294) is a trihydroxyflavone (CHEBI:27116) |
| kaempferol 3-O-β-D-xyloside (CHEBI:76294) is conjugate acid of kaempferol 3-O-β-D-xyloside(1−) (CHEBI:76272) |
| Incoming Relation(s) |
| kaempferol 3-O-β-D-xyloside(1−) (CHEBI:76272) is conjugate base of kaempferol 3-O-β-D-xyloside (CHEBI:76294) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-3-yl β-D-xylopyranoside |
| Synonym | Source |
|---|---|
| kaempferol 3-O-β-D-xylopyranoside | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-15540 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7575960 | Reaxys |
| Citations |
|---|