EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H36O4 |
| Net Charge | 0 |
| Average Mass | 436.592 |
| Monoisotopic Mass | 436.26136 |
| SMILES | [H][C@]12CC[C@]3(C)C(=CC[C@@]3([H])c3ccoc3)[C@]1(C)[C@H](OC(C)=O)C[C@@]1([H])C(C)(C)C(=O)C=C[C@]21C |
| InChI | InChI=1S/C28H36O4/c1-17(29)32-24-15-22-25(2,3)23(30)10-13-27(22,5)21-9-12-26(4)19(18-11-14-31-16-18)7-8-20(26)28(21,24)6/h8,10-11,13-14,16,19,21-22,24H,7,9,12,15H2,1-6H3/t19-,21+,22-,24+,26-,27+,28-/m0/s1 |
| InChIKey | XXIKKMLIDXLAIK-RFKFVWFBSA-N |
| Roles Classification |
|---|
| Biological Roles: | antiplasmodial drug An antiparasitic drug which is effective against Apicomplexan parasites in the genus Plasmodium. The genus contains over 200 species and includes those responsible for malaria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | antiplasmodial drug An antiparasitic drug which is effective against Apicomplexan parasites in the genus Plasmodium. The genus contains over 200 species and includes those responsible for malaria. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azadirone (CHEBI:76293) has role antineoplastic agent (CHEBI:35610) |
| azadirone (CHEBI:76293) has role antiplasmodial drug (CHEBI:64915) |
| azadirone (CHEBI:76293) has role plant metabolite (CHEBI:76924) |
| azadirone (CHEBI:76293) is a acetate ester (CHEBI:47622) |
| azadirone (CHEBI:76293) is a cyclic terpene ketone (CHEBI:36130) |
| azadirone (CHEBI:76293) is a furans (CHEBI:24129) |
| azadirone (CHEBI:76293) is a limonoid (CHEBI:39434) |
| azadirone (CHEBI:76293) is a tetracyclic triterpenoid (CHEBI:26893) |
| Incoming Relation(s) |
| 20,21,22,23-tetrahydro-23-oxoazadirone (CHEBI:67291) has functional parent azadirone (CHEBI:76293) |
| IUPAC Name |
|---|
| (5α,7α,13α,17α)-17-(furan-3-yl)-4,4,8-trimethyl-3-oxoandrosta-1,14-dien-7-yl acetate |
| UniProt Name | Source |
|---|---|
| azadirone | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4214438 | Reaxys |
| CAS:25279-67-8 | ChemIDplus |
| Citations |
|---|