EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H12N4 |
| Net Charge | 0 |
| Average Mass | 224.267 |
| Monoisotopic Mass | 224.10620 |
| SMILES | Cn1c(N)nc2ncc(-c3ccccc3)cc21 |
| InChI | InChI=1S/C13H12N4/c1-17-11-7-10(9-5-3-2-4-6-9)8-15-12(11)16-13(17)14/h2-8H,1H3,(H2,14,15,16) |
| InChIKey | UQVKZNNCIHJZLS-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PhIP (CHEBI:76290) has role carcinogenic agent (CHEBI:50903) |
| PhIP (CHEBI:76290) has role mutagen (CHEBI:25435) |
| PhIP (CHEBI:76290) is a imidazopyridine (CHEBI:46908) |
| PhIP (CHEBI:76290) is a primary amino compound (CHEBI:50994) |
| Incoming Relation(s) |
| N-hydroxy-PhIP (CHEBI:133920) has functional parent PhIP (CHEBI:76290) |
| IUPAC Name |
|---|
| 1-methyl-6-phenyl-1H-imidazo[4,5-b]pyridin-2-amine |
| Synonyms | Source |
|---|---|
| 2-amino-1-methyl-6-phenylimidazo[4,5-b]pyridine | ChemIDplus |
| PhIP | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 2-Amino-1-methyl-6-phenylimidazo(4,5-b)pyridine | Wikipedia |
| C16038 | KEGG COMPOUND |
| HMDB0041008 | HMDB |
| PIQ | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5951264 | Reaxys |
| CAS:105650-23-5 | ChemIDplus |
| CAS:105650-23-5 | KEGG COMPOUND |
| Citations |
|---|