EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H10N2 |
| Net Charge | 0 |
| Average Mass | 122.171 |
| Monoisotopic Mass | 122.08440 |
| SMILES | Cc1c(N)cccc1N |
| InChI | InChI=1S/C7H10N2/c1-5-6(8)3-2-4-7(5)9/h2-4H,8-9H2,1H3 |
| InChIKey | RLYCRLGLCUXUPO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,6-diaminotoluene (CHEBI:76288) has parent hydride toluene (CHEBI:17578) |
| 2,6-diaminotoluene (CHEBI:76288) has role mutagen (CHEBI:25435) |
| 2,6-diaminotoluene (CHEBI:76288) is a diamine (CHEBI:23666) |
| 2,6-diaminotoluene (CHEBI:76288) is a primary amino compound (CHEBI:50994) |
| IUPAC Name |
|---|
| 2-methylbenzene-1,3-diamine |
| Synonyms | Source |
|---|---|
| 2,6-DAT | ChEBI |
| 2,6-diamino-1-methylbenzene | ChemIDplus |
| 2,6-toluylenediamine | ChemIDplus |
| 2,6-tolylenediamine | ChemIDplus |
| 2-methyl-1,3-benzenediamine | ChemIDplus |
| 2-methyl-1,3-phenylenediamine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0041801 | HMDB |
| Citations |
|---|