EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20ClN3O3 |
| Net Charge | 0 |
| Average Mass | 385.851 |
| Monoisotopic Mass | 385.11932 |
| SMILES | COc1ccc(-n2nc(CCC(=O)N(C)O)cc2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C20H20ClN3O3/c1-23(26)20(25)12-7-16-13-19(14-3-5-15(21)6-4-14)24(22-16)17-8-10-18(27-2)11-9-17/h3-6,8-11,13,26H,7,12H2,1-2H3 |
| InChIKey | XYKWNRUXCOIMFZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | lipoxygenase inhibitor A compound or agent that combines with lipoxygenase and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of the icosanoid products hydroxyicosatetraenoic acid and various leukotrienes. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. apoptosis inhibitor Any substance that inhibits the process of apoptosis (programmed cell death) in multi-celled organisms. EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor A compound or agent that combines with cyclooxygenases (EC 1.14.99.1) and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of icosanoids, prostaglandins, and thromboxanes. |
| Applications: | non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. antipyretic A drug that prevents or reduces fever by lowering the body temperature from a raised state. An antipyretic will not affect the normal body temperature if one does not have fever. Antipyretics cause the hypothalamus to override an interleukin-induced increase in temperature. The body will then work to lower the temperature and the result is a reduction in fever. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tepoxalin (CHEBI:76277) has role antipyretic (CHEBI:35493) |
| tepoxalin (CHEBI:76277) has role apoptosis inhibitor (CHEBI:68494) |
| tepoxalin (CHEBI:76277) has role EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor (CHEBI:35544) |
| tepoxalin (CHEBI:76277) has role immunomodulator (CHEBI:50846) |
| tepoxalin (CHEBI:76277) has role lipoxygenase inhibitor (CHEBI:35856) |
| tepoxalin (CHEBI:76277) has role non-narcotic analgesic (CHEBI:35481) |
| tepoxalin (CHEBI:76277) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| tepoxalin (CHEBI:76277) is a aromatic ether (CHEBI:35618) |
| tepoxalin (CHEBI:76277) is a hydroxamic acid (CHEBI:24650) |
| tepoxalin (CHEBI:76277) is a monochlorobenzenes (CHEBI:83403) |
| tepoxalin (CHEBI:76277) is a pyrazoles (CHEBI:26410) |
| IUPAC Name |
|---|
| 3-[5-(4-chlorophenyl)-1-(4-methoxyphenyl)-1H-pyrazol-3-yl]-N-hydroxy-N-methylpropanamide |
| INNs | Source |
|---|---|
| tepoxalin | KEGG DRUG |
| tepoxalina | ChemIDplus |
| tepoxaline | ChemIDplus |
| tepoxaliume | ChemIDplus |
| Synonyms | Source |
|---|---|
| 5-(p-Chlorophenyl)-1-(p-methoxyphenyl)-N-methylpyrazole-3-propionohydroxamic acid | ChemIDplus |
| ORF 20485 | ChemIDplus |
| ORF-20485 | ChemIDplus |
| RWJ 20485 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Zubrin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 1877 | VSDB |
| C18362 | KEGG COMPOUND |
| D06075 | KEGG DRUG |
| Tepoxalin | Wikipedia |
| WO2007022427 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4334297 | Reaxys |
| CAS:103475-41-8 | KEGG COMPOUND |
| CAS:103475-41-8 | KEGG DRUG |
| CAS:103475-41-8 | ChemIDplus |
| Citations |
|---|