EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20ClN3O3 |
| Net Charge | 0 |
| Average Mass | 385.851 |
| Monoisotopic Mass | 385.11932 |
| SMILES | COc1ccc(-n2nc(CCC(=O)N(C)O)cc2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C20H20ClN3O3/c1-23(26)20(25)12-7-16-13-19(14-3-5-15(21)6-4-14)24(22-16)17-8-10-18(27-2)11-9-17/h3-6,8-11,13,26H,7,12H2,1-2H3 |
| InChIKey | XYKWNRUXCOIMFZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor A compound or agent that combines with cyclooxygenases (EC 1.14.99.1) and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of icosanoids, prostaglandins, and thromboxanes. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. apoptosis inhibitor Any substance that inhibits the process of apoptosis (programmed cell death) in multi-celled organisms. immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. lipoxygenase inhibitor A compound or agent that combines with lipoxygenase and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of the icosanoid products hydroxyicosatetraenoic acid and various leukotrienes. |
| Applications: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. antipyretic A drug that prevents or reduces fever by lowering the body temperature from a raised state. An antipyretic will not affect the normal body temperature if one does not have fever. Antipyretics cause the hypothalamus to override an interleukin-induced increase in temperature. The body will then work to lower the temperature and the result is a reduction in fever. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tepoxalin (CHEBI:76277) has role antipyretic (CHEBI:35493) |
| tepoxalin (CHEBI:76277) has role apoptosis inhibitor (CHEBI:68494) |
| tepoxalin (CHEBI:76277) has role EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor (CHEBI:35544) |
| tepoxalin (CHEBI:76277) has role immunomodulator (CHEBI:50846) |
| tepoxalin (CHEBI:76277) has role lipoxygenase inhibitor (CHEBI:35856) |
| tepoxalin (CHEBI:76277) has role non-narcotic analgesic (CHEBI:35481) |
| tepoxalin (CHEBI:76277) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| tepoxalin (CHEBI:76277) is a aromatic ether (CHEBI:35618) |
| tepoxalin (CHEBI:76277) is a hydroxamic acid (CHEBI:24650) |
| tepoxalin (CHEBI:76277) is a monochlorobenzenes (CHEBI:83403) |
| tepoxalin (CHEBI:76277) is a pyrazoles (CHEBI:26410) |
| IUPAC Name |
|---|
| 3-[5-(4-chlorophenyl)-1-(4-methoxyphenyl)-1H-pyrazol-3-yl]-N-hydroxy-N-methylpropanamide |
| INNs | Source |
|---|---|
| tepoxalin | KEGG DRUG |
| tepoxalina | ChemIDplus |
| tepoxaline | ChemIDplus |
| tepoxaliume | ChemIDplus |
| Synonyms | Source |
|---|---|
| 5-(p-Chlorophenyl)-1-(p-methoxyphenyl)-N-methylpyrazole-3-propionohydroxamic acid | ChemIDplus |
| ORF 20485 | ChemIDplus |
| ORF-20485 | ChemIDplus |
| RWJ 20485 | ChemIDplus |
| RWJ-20485 | ChEMBL |
| Brand Name | Source |
|---|---|
| Zubrin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 1877 | VSDB |
| C18362 | KEGG COMPOUND |
| D06075 | KEGG DRUG |
| Tepoxalin | Wikipedia |
| WO2007022427 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4334297 | Reaxys |
| CAS:103475-41-8 | KEGG DRUG |
| CAS:103475-41-8 | KEGG COMPOUND |
| CAS:103475-41-8 | ChemIDplus |
| Citations |
|---|