EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H28O4 |
| Net Charge | -2 |
| Average Mass | 284.396 |
| Monoisotopic Mass | 284.19986 |
| SMILES | O=C([O-])CCCCCCCCCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C16H30O4/c17-15(18)13-11-9-7-5-3-1-2-4-6-8-10-12-14-16(19)20/h1-14H2,(H,17,18)(H,19,20)/p-2 |
| InChIKey | QQHJDPROMQRDLA-UHFFFAOYSA-L |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (21886157) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hexadecanedioate(2−) (CHEBI:76276) has role human metabolite (CHEBI:77746) |
| hexadecanedioate(2−) (CHEBI:76276) is a saturated dicarboxylic acid dianion(2−) (CHEBI:133291) |
| hexadecanedioate(2−) (CHEBI:76276) is conjugate base of hexadecanedioic acid (CHEBI:73722) |
| Incoming Relation(s) |
| hexadecanedioic acid (CHEBI:73722) is conjugate acid of hexadecanedioate(2−) (CHEBI:76276) |
| Synonyms | Source |
|---|---|
| C16DCA(2−) | SUBMITTER |
| α,ω-hexadecanedioate | ChEBI |
| UniProt Name | Source |
|---|---|
| hexadecanedioate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-10511 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3908572 | Reaxys |
| Citations |
|---|