EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H12ClF3N2O |
| Net Charge | 0 |
| Average Mass | 352.743 |
| Monoisotopic Mass | 352.05903 |
| SMILES | COc1ccc(-n2nc(C(F)(F)F)cc2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C17H12ClF3N2O/c1-24-14-8-6-13(7-9-14)23-15(10-16(22-23)17(19,20)21)11-2-4-12(18)5-3-11/h2-10H,1H3 |
| InChIKey | PQUGCKBLVKJMNT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. cyclooxygenase 1 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 1. |
| Applications: | angiogenesis modulating agent An agent that modulates the physiologic angiogenesis process. This is accomplished by endogenous angiogenic proteins and a variety of other chemicals and pharmaceutical agents. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SC560 (CHEBI:76274) has role angiogenesis modulating agent (CHEBI:50926) |
| SC560 (CHEBI:76274) has role antineoplastic agent (CHEBI:35610) |
| SC560 (CHEBI:76274) has role apoptosis inducer (CHEBI:68495) |
| SC560 (CHEBI:76274) has role cyclooxygenase 1 inhibitor (CHEBI:50630) |
| SC560 (CHEBI:76274) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| SC560 (CHEBI:76274) is a aromatic ether (CHEBI:35618) |
| SC560 (CHEBI:76274) is a monochlorobenzenes (CHEBI:83403) |
| SC560 (CHEBI:76274) is a organofluorine compound (CHEBI:37143) |
| SC560 (CHEBI:76274) is a pyrazoles (CHEBI:26410) |
| IUPAC Name |
|---|
| 5-(4-chlorophenyl)-1-(4-methoxyphenyl)-3-(trifluoromethyl)-1H-pyrazole |
| Synonyms | Source |
|---|---|
| 5-(4-chlorophenyl)-1-(4-methoxyphenyl)-3-trifluoromethylpyrazole | ChemIDplus |
| SC 560 | ChEBI |
| SC-560 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-2314 | LINCS |
| WO2008076703 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7719788 | Reaxys |
| CAS:188817-13-2 | ChemIDplus |
| Citations |
|---|