EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H12ClF3N2O |
| Net Charge | 0 |
| Average Mass | 352.743 |
| Monoisotopic Mass | 352.05903 |
| SMILES | COc1ccc(-n2nc(C(F)(F)F)cc2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C17H12ClF3N2O/c1-24-14-8-6-13(7-9-14)23-15(10-16(22-23)17(19,20)21)11-2-4-12(18)5-3-11/h2-10H,1H3 |
| InChIKey | PQUGCKBLVKJMNT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | cyclooxygenase 1 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 1. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. angiogenesis modulating agent An agent that modulates the physiologic angiogenesis process. This is accomplished by endogenous angiogenic proteins and a variety of other chemicals and pharmaceutical agents. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SC560 (CHEBI:76274) has role angiogenesis modulating agent (CHEBI:50926) |
| SC560 (CHEBI:76274) has role antineoplastic agent (CHEBI:35610) |
| SC560 (CHEBI:76274) has role apoptosis inducer (CHEBI:68495) |
| SC560 (CHEBI:76274) has role cyclooxygenase 1 inhibitor (CHEBI:50630) |
| SC560 (CHEBI:76274) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| SC560 (CHEBI:76274) is a aromatic ether (CHEBI:35618) |
| SC560 (CHEBI:76274) is a monochlorobenzenes (CHEBI:83403) |
| SC560 (CHEBI:76274) is a organofluorine compound (CHEBI:37143) |
| SC560 (CHEBI:76274) is a pyrazoles (CHEBI:26410) |
| IUPAC Name |
|---|
| 5-(4-chlorophenyl)-1-(4-methoxyphenyl)-3-(trifluoromethyl)-1H-pyrazole |
| Synonyms | Source |
|---|---|
| 5-(4-chlorophenyl)-1-(4-methoxyphenyl)-3-trifluoromethylpyrazole | ChemIDplus |
| SC 560 | ChEBI |
| SC-560 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-2314 | LINCS |
| WO2008076703 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7719788 | Reaxys |
| CAS:188817-13-2 | ChemIDplus |
| Citations |
|---|