EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H17ClN2O4 |
| Net Charge | 0 |
| Average Mass | 372.808 |
| Monoisotopic Mass | 372.08768 |
| SMILES | COc1ccc2c(c1)c(CC(=O)NO)c(C)n2C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H17ClN2O4/c1-11-15(10-18(23)21-25)16-9-14(26-2)7-8-17(16)22(11)19(24)12-3-5-13(20)6-4-12/h3-9,25H,10H2,1-2H3,(H,21,23) |
| InChIKey | AJRNYCDWNITGHF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor A compound or agent that combines with cyclooxygenases (EC 1.14.99.1) and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of icosanoids, prostaglandins, and thromboxanes. |
| Applications: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxametacin (CHEBI:76255) has functional parent indometacin (CHEBI:49662) |
| oxametacin (CHEBI:76255) has role EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor (CHEBI:35544) |
| oxametacin (CHEBI:76255) has role non-narcotic analgesic (CHEBI:35481) |
| oxametacin (CHEBI:76255) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| oxametacin (CHEBI:76255) is a N-acylindole (CHEBI:75884) |
| oxametacin (CHEBI:76255) is a aromatic ether (CHEBI:35618) |
| oxametacin (CHEBI:76255) is a hydroxamic acid (CHEBI:24650) |
| oxametacin (CHEBI:76255) is a organochlorine compound (CHEBI:36683) |
| IUPAC Name |
|---|
| 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methyl-1H-indol-3-yl]-N-hydroxyacetamide |
| INNs | Source |
|---|---|
| oxametacin | KEGG DRUG |
| oxametacina | ChemIDplus |
| oxamétacine | WHO MedNet |
| oxametacinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-(4-Chlorobenzoyl)-N-hydroxy-5-methoxy-2-methyl-1H-indole-3-acetamide | ChemIDplus |
| 1-(p-Chlorobenzoyl)-5-methoxy-2-methyl-3-indolylacetohydroxamic acid | ChemIDplus |
| 1-(p-Chlorobenzoyl)-5-methoxy-2-methylindole-3-acetohydroxamic acid | ChemIDplus |
| Indoxamic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:497721 | Reaxys |
| CAS:27035-30-9 | KEGG DRUG |
| CAS:27035-30-9 | ChemIDplus |
| Citations |
|---|