EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16N2O2 |
| Net Charge | 0 |
| Average Mass | 232.283 |
| Monoisotopic Mass | 232.12118 |
| SMILES | CCCCC1C(=O)NN(c2ccccc2)C1=O |
| InChI | InChI=1S/C13H16N2O2/c1-2-3-9-11-12(16)14-15(13(11)17)10-7-5-4-6-8-10/h4-8,11H,2-3,9H2,1H3,(H,14,16) |
| InChIKey | REOJLIXKJWXUGB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mofebutazone (CHEBI:76252) has role non-narcotic analgesic (CHEBI:35481) |
| mofebutazone (CHEBI:76252) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| mofebutazone (CHEBI:76252) is a pyrazolidines (CHEBI:38312) |
| IUPAC Name |
|---|
| 4-butyl-1-phenylpyrazolidine-3,5-dione |
| INNs | Source |
|---|---|
| mofebutazone | KEGG DRUG |
| mofebutazonum | ChemIDplus |
| mofebutazona | ChemIDplus |
| mofébutazone | WHO MedNet |
| nabumétone | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2-Phenyl-3,5-dihydroxy-4-butylpyrazolidine | ChemIDplus |
| 2 Fdbp | ChemIDplus |
| 4-Butyl-1-phenyl-3,5-pyrazolidinedione | ChemIDplus |
| 4-Butyl-1-phenyl-3,5-dioxopyrazolidine | ChemIDplus |
| Monophenylbutazone | ChemIDplus |
| Mophebutazone | ChemIDplus |
| Brand Name | Source |
|---|---|
| Monazone | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| Mofebutazone | Wikipedia |
| 1828 | DrugCentral |
| Citations |
|---|