EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14N2O2 |
| Net Charge | 0 |
| Average Mass | 266.300 |
| Monoisotopic Mass | 266.10553 |
| SMILES | CC(C(=O)O)c1ccc(-c2cn3ccccc3n2)cc1 |
| InChI | InChI=1S/C16H14N2O2/c1-11(16(19)20)12-5-7-13(8-6-12)14-10-18-9-3-2-4-15(18)17-14/h2-11H,1H3,(H,19,20) |
| InChIKey | OJGQFYYLKNCIJD-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. antipyretic A drug that prevents or reduces fever by lowering the body temperature from a raised state. An antipyretic will not affect the normal body temperature if one does not have fever. Antipyretics cause the hypothalamus to override an interleukin-induced increase in temperature. The body will then work to lower the temperature and the result is a reduction in fever. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| miroprofen (CHEBI:76249) has functional parent propionic acid (CHEBI:30768) |
| miroprofen (CHEBI:76249) has role antipyretic (CHEBI:35493) |
| miroprofen (CHEBI:76249) has role non-narcotic analgesic (CHEBI:35481) |
| miroprofen (CHEBI:76249) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| miroprofen (CHEBI:76249) has role platelet aggregation inhibitor (CHEBI:50427) |
| miroprofen (CHEBI:76249) is a imidazopyridine (CHEBI:46908) |
| miroprofen (CHEBI:76249) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 2-[4-(imidazo[1,2-a]pyridin-2-yl)phenyl]propanoic acid |
| INNs | Source |
|---|---|
| miroprofen | ChemIDplus |
| miroprofene | ChemIDplus |
| miroprofeno | ChemIDplus |
| miroprofenum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-(p-(2-Imidazo(1,2-a)pyridyl)phenyl)propionic acid | ChemIDplus |
| 4-Imidazo(1,2-a)pyridin-2-yl-alpha-methylbenzeneacetic acid | ChemIDplus |
| p-Imidazo(1,2-a)pyridin-2-ylhydratropic acid | ChemIDplus |
| Y 9213 | ChemIDplus |
| Y-9213 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Miroprofen | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:888858 | Reaxys |
| CAS:55843-86-2 | ChemIDplus |
| Citations |
|---|