EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H30O2 |
| Net Charge | 0 |
| Average Mass | 254.414 |
| Monoisotopic Mass | 254.22458 |
| SMILES | CCCCCCCCC/C=C\CCCCC(=O)O |
| InChI | InChI=1S/C16H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h10-11H,2-9,12-15H2,1H3,(H,17,18)/b11-10- |
| InChIKey | NNNVXFKZMRGJPM-KHPPLWFESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antipsoriatic A drug used to treat psoriasis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sapienic acid (CHEBI:76244) has role antibacterial agent (CHEBI:33282) |
| sapienic acid (CHEBI:76244) has role antipsoriatic (CHEBI:50748) |
| sapienic acid (CHEBI:76244) has role metabolite (CHEBI:25212) |
| sapienic acid (CHEBI:76244) is a hexadecenoic acid (CHEBI:24548) |
| sapienic acid (CHEBI:76244) is conjugate acid of sapienate (CHEBI:76197) |
| Incoming Relation(s) |
| (6Z)-hexadecenoyl-CoA (CHEBI:74610) has functional parent sapienic acid (CHEBI:76244) |
| sapienoyl bioconjugate (CHEBI:76195) has functional parent sapienic acid (CHEBI:76244) |
| sapienate (CHEBI:76197) is conjugate base of sapienic acid (CHEBI:76244) |
| IUPAC Name |
|---|
| (6Z)-hexadec-6-enoic acid |
| Synonyms | Source |
|---|---|
| 16:1omega10 | ChemIDplus |
| 6Z-hexadecenoic acid | LIPID MAPS |
| cis-6-Hexadecenoic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| CPD-14393 | MetaCyc |
| EP0996438 | Patent |
| LMFA01030267 | LIPID MAPS |
| Sapienic_acid | Wikipedia |
| US4036991 | Patent |
| US6589520 | Patent |
| WO9856371 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9641382 | Reaxys |
| CAS:17004-51-2 | ChemIDplus |
| Citations |
|---|