EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H30O2 |
| Net Charge | 0 |
| Average Mass | 254.414 |
| Monoisotopic Mass | 254.22458 |
| SMILES | CCCCCCCCC/C=C\CCCCC(=O)O |
| InChI | InChI=1S/C16H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h10-11H,2-9,12-15H2,1H3,(H,17,18)/b11-10- |
| InChIKey | NNNVXFKZMRGJPM-KHPPLWFESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | antipsoriatic A drug used to treat psoriasis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sapienic acid (CHEBI:76244) has role antibacterial agent (CHEBI:33282) |
| sapienic acid (CHEBI:76244) has role antipsoriatic (CHEBI:50748) |
| sapienic acid (CHEBI:76244) has role metabolite (CHEBI:25212) |
| sapienic acid (CHEBI:76244) is a hexadecenoic acid (CHEBI:24548) |
| sapienic acid (CHEBI:76244) is conjugate acid of sapienate (CHEBI:76197) |
| Incoming Relation(s) |
| (6Z)-hexadecenoyl-CoA (CHEBI:74610) has functional parent sapienic acid (CHEBI:76244) |
| sapienoyl bioconjugate (CHEBI:76195) has functional parent sapienic acid (CHEBI:76244) |
| sapienate (CHEBI:76197) is conjugate base of sapienic acid (CHEBI:76244) |
| IUPAC Name |
|---|
| (6Z)-hexadec-6-enoic acid |
| Synonyms | Source |
|---|---|
| 16:1omega10 | ChemIDplus |
| 6Z-hexadecenoic acid | LIPID MAPS |
| cis-6-Hexadecenoic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| CPD-14393 | MetaCyc |
| EP0996438 | Patent |
| LMFA01030267 | LIPID MAPS |
| Sapienic_acid | Wikipedia |
| US4036991 | Patent |
| US6589520 | Patent |
| WO9856371 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9641382 | Reaxys |
| CAS:17004-51-2 | ChemIDplus |
| Citations |
|---|