EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H52O3 |
| Net Charge | 0 |
| Average Mass | 460.743 |
| Monoisotopic Mass | 460.39165 |
| SMILES | [H][C@]12C[C@@H](O)[C@]3([H])[C@@]([H])([C@](C)(O)CCC=C(C)C)CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](O)CC[C@]21C |
| InChI | InChI=1S/C30H52O3/c1-19(2)10-9-14-30(8,33)20-11-16-29(7)25(20)21(31)18-23-27(5)15-13-24(32)26(3,4)22(27)12-17-28(23,29)6/h10,20-25,31-33H,9,11-18H2,1-8H3/t20-,21+,22-,23+,24-,25-,27-,28+,29+,30+/m0/s1 |
| InChIKey | PYXFVCFISTUSOO-VUFVRDRTSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (20R)-protopanaxadiol (CHEBI:76237) is a protopanaxadiol (CHEBI:76238) |
| IUPAC Name |
|---|
| (3β,12β,20R)-dammar-24-ene-3,12,20-triol |
| Synonyms | Source |
|---|---|
| protopanaxadiol | ChEBI |
| dammar-24-ene-3β,12β,20R-triol | LIPID MAPS |
| 24-dammarene-3β,12β,20R-triol | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| US2003190378 | Patent |
| WO2006001654 | Patent |
| LMPR0106080003 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3086790 | Reaxys |
| CAS:7755-01-3 | ChemIDplus |
| Citations |
|---|