EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H60O3 |
| Net Charge | 0 |
| Average Mass | 468.807 |
| Monoisotopic Mass | 468.45425 |
| SMILES | O=C(O)CCCCCCCCCCCCCCCCCCCCCCCCCCCCCO |
| InChI | InChI=1S/C30H60O3/c31-29-27-25-23-21-19-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18-20-22-24-26-28-30(32)33/h31H,1-29H2,(H,32,33) |
| InChIKey | IRPZBVZGZKVXHG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ω-hydroxytriacontanoic acid (CHEBI:76220) has functional parent triacontanoic acid (CHEBI:31003) |
| ω-hydroxytriacontanoic acid (CHEBI:76220) is a straight-chain fatty acid (CHEBI:59202) |
| ω-hydroxytriacontanoic acid (CHEBI:76220) is a ω-hydroxy-ultra-long-chain fatty acid (CHEBI:147297) |
| ω-hydroxytriacontanoic acid (CHEBI:76220) is conjugate acid of ω-hydroxytriacontanoate (CHEBI:76044) |
| Incoming Relation(s) |
| N-(ω-hydroxytriacontanoyl)sphingosine (CHEBI:138664) has functional parent ω-hydroxytriacontanoic acid (CHEBI:76220) |
| ω-hydroxytriacontanoate (CHEBI:76044) is conjugate base of ω-hydroxytriacontanoic acid (CHEBI:76220) |
| IUPAC Name |
|---|
| 30-hydroxytriacontanoic acid |
| Synonyms | Source |
|---|---|
| 30-hydroxymelissic acid | ChEBI |
| ω-hydroxymelissic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01050221 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1805770 | Reaxys |