EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H52O3 |
| Net Charge | 0 |
| Average Mass | 412.699 |
| Monoisotopic Mass | 412.39165 |
| SMILES | CCCCCCCCCCCCCCCCCCCCCCCC[C@@H](O)C(=O)O |
| InChI | InChI=1S/C26H52O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25(27)26(28)29/h25,27H,2-24H2,1H3,(H,28,29)/t25-/m1/s1 |
| InChIKey | IFYDZTDBJZWEPK-RUZDIDTESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-2-hydroxyhexacosanoic acid (CHEBI:76218) has functional parent hexacosanoic acid (CHEBI:31009) |
| (R)-2-hydroxyhexacosanoic acid (CHEBI:76218) is a 2-hydroxy fatty acid (CHEBI:10283) |
| (R)-2-hydroxyhexacosanoic acid (CHEBI:76218) is a very long-chain fatty acid (CHEBI:27283) |
| (R)-2-hydroxyhexacosanoic acid (CHEBI:76218) is conjugate acid of (R)-2-hydroxyhexacosanoate (CHEBI:76030) |
| Incoming Relation(s) |
| (R)-2-hydroxyhexacosanoate (CHEBI:76030) is conjugate base of (R)-2-hydroxyhexacosanoic acid (CHEBI:76218) |
| IUPAC Name |
|---|
| (2R)-2-hydroxyhexacosanoic acid |
| Synonyms | Source |
|---|---|
| (R)-2-hydroxycerotic acid | LIPID MAPS |
| (R)-α-hydroxyhexacosanoic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA01050263 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1729300 | Reaxys |