EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H16 |
| Net Charge | 0 |
| Average Mass | 244.337 |
| Monoisotopic Mass | 244.12520 |
| SMILES | c1ccc(C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H16/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15,19H |
| InChIKey | AAAQKTZKLRYKHR-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triphenylmethane (CHEBI:76212) has role environmental contaminant (CHEBI:78298) |
| triphenylmethane (CHEBI:76212) has role xenobiotic (CHEBI:35703) |
| triphenylmethane (CHEBI:76212) is a triarylmethane (CHEBI:76214) |
| Incoming Relation(s) |
| 4-{bis[4-(dimethylamino)phenyl]methyl}phenol (CHEBI:76210) has parent hydride triphenylmethane (CHEBI:76212) |
| IUPAC Name |
|---|
| 1,1',1''-methanetriyltribenzene |
| Synonyms | Source |
|---|---|
| 1,1',1''-methylidynetrisbenzene | ChEBI |
| 1,1,1-triphenylmethane | ChEBI |
| Tritane | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Triphenylmethane | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1909753 | Reaxys |
| CAS:519-73-3 | ChemIDplus |
| Citations |
|---|