EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H22O6 |
| Net Charge | 0 |
| Average Mass | 454.478 |
| Monoisotopic Mass | 454.14164 |
| SMILES | Oc1ccc(/C=C2/c3cc(O)cc(O)c3[C@@H](c3ccc(O)cc3)[C@@H]2c2cc(O)cc(O)c2)cc1 |
| InChI | InChI=1S/C28H22O6/c29-18-5-1-15(2-6-18)9-23-24-13-22(33)14-25(34)28(24)27(16-3-7-19(30)8-4-16)26(23)17-10-20(31)12-21(32)11-17/h1-14,26-27,29-34H/b23-9-/t26-,27+/m1/s1 |
| InChIKey | BIQMSWPBPAKGSE-PBSLAQMISA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| quadrangularin A (CHEBI:76192) has functional parent resveratrol (CHEBI:27881) |
| quadrangularin A (CHEBI:76192) has role antioxidant (CHEBI:22586) |
| quadrangularin A (CHEBI:76192) has role plant metabolite (CHEBI:76924) |
| quadrangularin A (CHEBI:76192) is a indanes (CHEBI:46940) |
| quadrangularin A (CHEBI:76192) is a polyphenol (CHEBI:26195) |
| quadrangularin A (CHEBI:76192) is a stilbenoid (CHEBI:26776) |
| IUPAC Name |
|---|
| (1E,2R,3R)-2-(3,5-dihydroxyphenyl)-1-(4-hydroxybenzylidene)-3-(4-hydroxyphenyl)-2,3-dihydro-1H-indene-4,6-diol |
| Manual Xrefs | Databases |
|---|---|
| Quadrangularin_A | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8370734 | Reaxys |
| Citations |
|---|