EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H22O6 |
| Net Charge | 0 |
| Average Mass | 454.478 |
| Monoisotopic Mass | 454.14164 |
| SMILES | [H][C@]12c3cc(O)cc(O)c3[C@H](c3ccc(O)cc3)Cc3cc(O)cc(c31)O[C@@H]2c1ccc(O)cc1 |
| InChI | InChI=1S/C28H22O6/c29-17-5-1-14(2-6-17)21-10-16-9-19(31)13-24-25(16)27(22-11-20(32)12-23(33)26(21)22)28(34-24)15-3-7-18(30)8-4-15/h1-9,11-13,21,27-33H,10H2/t21-,27-,28+/m0/s1 |
| InChIKey | JJCVXDDMIRXVJA-YNOBPPCASA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | lipoxygenase inhibitor A compound or agent that combines with lipoxygenase and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of the icosanoid products hydroxyicosatetraenoic acid and various leukotrienes. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ampelopsin B (CHEBI:76191) has functional parent resveratrol (CHEBI:27881) |
| ampelopsin B (CHEBI:76191) has role lipoxygenase inhibitor (CHEBI:35856) |
| ampelopsin B (CHEBI:76191) has role plant metabolite (CHEBI:76924) |
| ampelopsin B (CHEBI:76191) is a organic heterotetracyclic compound (CHEBI:38163) |
| ampelopsin B (CHEBI:76191) is a polyphenol (CHEBI:26195) |
| ampelopsin B (CHEBI:76191) is a stilbenoid (CHEBI:26776) |
| IUPAC Name |
|---|
| (1S,7S,11bS)-1,7-bis(4-hydroxyphenyl)-1,6,7,11b-tetrahydro-2-oxadibenzo[cd,h]azulene-4,8,10-triol |
| Manual Xrefs | Databases |
|---|---|
| Ampelopsin_B | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7957515 | Reaxys |
| Citations |
|---|