EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H22O6 |
| Net Charge | 0 |
| Average Mass | 454.478 |
| Monoisotopic Mass | 454.14164 |
| SMILES | [H][C@@]12c3cc(O)cc(O)c3[C@@H](c3ccc(O)cc3)[C@]1([H])c1cc(O)cc(O)c1[C@H]2c1ccc(O)cc1 |
| InChI | InChI=1S/C28H22O6/c29-15-5-1-13(2-6-15)23-25-19(9-17(31)11-21(25)33)28-24(14-3-7-16(30)8-4-14)26-20(27(23)28)10-18(32)12-22(26)34/h1-12,23-24,27-34H/t23-,24-,27+,28+/m1/s1 |
| InChIKey | YNVJOQCPHWKWSO-ZBVBGGFBSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pallidol (CHEBI:76173) has functional parent resveratrol (CHEBI:27881) |
| pallidol (CHEBI:76173) has role antifungal agent (CHEBI:35718) |
| pallidol (CHEBI:76173) has role antioxidant (CHEBI:22586) |
| pallidol (CHEBI:76173) has role plant metabolite (CHEBI:76924) |
| pallidol (CHEBI:76173) is a carbopolycyclic compound (CHEBI:35294) |
| pallidol (CHEBI:76173) is a polyphenol (CHEBI:26195) |
| pallidol (CHEBI:76173) is a stilbenoid (CHEBI:26776) |
| IUPAC Name |
|---|
| (4bR,5R,9bR,10R)-5,10-bis(4-hydroxyphenyl)-4b,5,9b,10-tetrahydroindeno[2,1-a]indene-1,3,6,8-tetrol |
| Manual Xrefs | Databases |
|---|---|
| Pallidol | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7152851 | Reaxys |
| Citations |
|---|