EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18O3 |
| Net Charge | 0 |
| Average Mass | 246.306 |
| Monoisotopic Mass | 246.12559 |
| SMILES | CC(C(=O)O)c1ccc(CC2CCCC2=O)cc1 |
| InChI | InChI=1S/C15H18O3/c1-10(15(17)18)12-7-5-11(6-8-12)9-13-3-2-4-14(13)16/h5-8,10,13H,2-4,9H2,1H3,(H,17,18) |
| InChIKey | YMBXTVYHTMGZDW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor A compound or agent that combines with cyclooxygenases (EC 1.14.99.1) and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of icosanoids, prostaglandins, and thromboxanes. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. antipyretic A drug that prevents or reduces fever by lowering the body temperature from a raised state. An antipyretic will not affect the normal body temperature if one does not have fever. Antipyretics cause the hypothalamus to override an interleukin-induced increase in temperature. The body will then work to lower the temperature and the result is a reduction in fever. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| loxoprofen (CHEBI:76172) has functional parent propionic acid (CHEBI:30768) |
| loxoprofen (CHEBI:76172) has role antipyretic (CHEBI:35493) |
| loxoprofen (CHEBI:76172) has role EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor (CHEBI:35544) |
| loxoprofen (CHEBI:76172) has role non-narcotic analgesic (CHEBI:35481) |
| loxoprofen (CHEBI:76172) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| loxoprofen (CHEBI:76172) has role prodrug (CHEBI:50266) |
| loxoprofen (CHEBI:76172) is a cyclopentanones (CHEBI:36140) |
| loxoprofen (CHEBI:76172) is a monocarboxylic acid (CHEBI:25384) |
| loxoprofen (CHEBI:76172) is conjugate acid of loxoprofen(1−) (CHEBI:76199) |
| Incoming Relation(s) |
| (2S)-2-(4-{[(1R,2S)-2-hydroxycyclopentyl]methyl}phenyl)propanoic acid (CHEBI:76204) has functional parent loxoprofen (CHEBI:76172) |
| loxoprofen(1−) (CHEBI:76199) is conjugate base of loxoprofen (CHEBI:76172) |
| IUPAC Name |
|---|
| 2-{4-[(2-oxocyclopentyl)methyl]phenyl}propanoic acid |
| INNs | Source |
|---|---|
| loxoprofen | KEGG DRUG |
| loxoprofene | ChemIDplus |
| loxoprofeno | ChemIDplus |
| loxoprofenum | ChemIDplus |
| Synonym | Source |
|---|---|
| (±)-((2-oxocyclopentyl)methyl)hydratropic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1615 | DrugCentral |
| D08149 | KEGG DRUG |
| EP1767218 | Patent |
| HMDB0041920 | HMDB |
| Loxoprofen | Wikipedia |
| LSM-5054 | LINCS |
| WO2008020270 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2860055 | Reaxys |
| CAS:68767-14-6 | KEGG DRUG |
| CAS:68767-14-6 | ChemIDplus |