EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:76167 - lonazolac calcium
| Formula | 2C17H12ClN2O2.Ca |
| Net Charge | 0 |
| Average Mass | 663.574 |
| Monoisotopic Mass | 662.08005 |
| SMILES | O=C([O-])Cc1cn(-c2ccccc2)nc1-c1ccc(Cl)cc1.O=C([O-])Cc1cn(-c2ccccc2)nc1-c1ccc(Cl)cc1.[Ca+2] |
| InChI | InChI=1S/2C17H13ClN2O2.Ca/c2*18-14-8-6-12(7-9-14)17-13(10-16(21)22)11-20(19-17)15-4-2-1-3-5-15;/h2*1-9,11H,10H2,(H,21,22);/q;;+2/p-2 |
| InChIKey | CAQGVXNKMLYRMF-UHFFFAOYSA-L |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor A compound or agent that combines with cyclooxygenases (EC 1.14.99.1) and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of icosanoids, prostaglandins, and thromboxanes. |
| Applications: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lonazolac calcium (CHEBI:76167) has part lonazolac(1−) (CHEBI:76169) |
| lonazolac calcium (CHEBI:76167) has role antineoplastic agent (CHEBI:35610) |
| lonazolac calcium (CHEBI:76167) has role EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor (CHEBI:35544) |
| lonazolac calcium (CHEBI:76167) has role non-narcotic analgesic (CHEBI:35481) |
| lonazolac calcium (CHEBI:76167) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| lonazolac calcium (CHEBI:76167) is a organic calcium salt (CHEBI:51031) |
| IUPAC Name |
|---|
| calcium bis{[3-(4-chlorophenyl)-1-phenyl-1H-pyrazol-4-yl]acetate} |
| Synonyms | Source |
|---|---|
| Lonazolac calcium salt | KEGG DRUG |
| lonazolac.Ca | ChEBI |
| lonazolac-Ca | ChEBI |
| Citations |
|---|