EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H15NO3 |
| Net Charge | 0 |
| Average Mass | 281.311 |
| Monoisotopic Mass | 281.10519 |
| SMILES | CC(C(=O)O)c1ccc(N2Cc3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C17H15NO3/c1-11(17(20)21)12-6-8-14(9-7-12)18-10-13-4-2-3-5-15(13)16(18)19/h2-9,11H,10H2,1H3,(H,20,21) |
| InChIKey | RJMIEHBSYVWVIN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor A compound or agent that combines with cyclooxygenases (EC 1.14.99.1) and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of icosanoids, prostaglandins, and thromboxanes. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| indoprofen (CHEBI:76162) has functional parent propionic acid (CHEBI:30768) |
| indoprofen (CHEBI:76162) has role EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor (CHEBI:35544) |
| indoprofen (CHEBI:76162) has role non-narcotic analgesic (CHEBI:35481) |
| indoprofen (CHEBI:76162) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| indoprofen (CHEBI:76162) is a isoindoles (CHEBI:24897) |
| indoprofen (CHEBI:76162) is a monocarboxylic acid (CHEBI:25384) |
| indoprofen (CHEBI:76162) is a γ-lactam (CHEBI:74222) |
| IUPAC Name |
|---|
| 2-[4-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)phenyl]propanoic acid |
| INNs | Source |
|---|---|
| indoprofen | KEGG DRUG |
| indoprofene | ChemIDplus |
| indoprofeno | ChemIDplus |
| indoprofenum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-Oxo-2-(p-((alpha-methyl)carboxymethyl)phenyl)isoindoline | ChemIDplus |
| 2-(4-(1-Carboxyethyl)phenyl)-1-isoindolinone | ChemIDplus |
| alpha-(4-(1-Oxo-2-isoindolinyl)phenyl)propionic acid | ChemIDplus |
| K 4277 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1442 | DrugCentral |
| D04530 | KEGG DRUG |
| Indoprofen | Wikipedia |
| LSM-1564 | LINCS |
| NZ586198 | Patent |
| WO2008011083 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1543920 | Reaxys |
| CAS:31842-01-0 | ChemIDplus |
| CAS:31842-01-0 | KEGG DRUG |
| Citations |
|---|