EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H19NO2 |
| Net Charge | 0 |
| Average Mass | 221.300 |
| Monoisotopic Mass | 221.14158 |
| SMILES | CC(C)Cc1ccc(C(C)C(=O)NO)cc1 |
| InChI | InChI=1S/C13H19NO2/c1-9(2)8-11-4-6-12(7-5-11)10(3)13(15)14-16/h4-7,9-10,16H,8H2,1-3H3,(H,14,15) |
| InChIKey | BYPIURIATSUHDW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | |
| Biological Role: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ibuproxam (CHEBI:76160) has functional parent ibuprofen (CHEBI:5855) |
| ibuproxam (CHEBI:76160) has role iron chelator (CHEBI:38157) |
| ibuproxam (CHEBI:76160) has role non-narcotic analgesic (CHEBI:35481) |
| ibuproxam (CHEBI:76160) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| ibuproxam (CHEBI:76160) is a hydroxamic acid (CHEBI:24650) |
| IUPAC Names |
|---|
| N-hydroxy-2-[4-(2-methylpropyl)phenyl]propanamide |
| N-hydroxy-2-(4-isobutylphenyl)propanamide |
| INNs | Source |
|---|---|
| ibuproxam | KEGG DRUG |
| ibuproxam | WHO MedNet |
| ibuproxam | WHO MedNet |
| ibuproxamum | WHO MedNet |
| Synonym | Source |
|---|---|
| p-Isobutylhydratropohydroxamic acid | ChemIDplus |
| Citations |
|---|